C17H12F3N3O4 — CID 29408654
3-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzofuran-2-carbohydrazide (PubChem CID 29408654) has the molecular formula C17H12F3N3O4 and a molecular weight of 379.29 g/mol. Its IUPAC name is 3-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 3-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 29408654 |
| Molecular Formula | C17H12F3N3O4 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])oc2ccccc12 |
| InChI | InChI=1S/C17H12F3N3O4/c1-9-11-4-2-3-5-14(11)27-15(9)16(24)22-21-12-7-6-10(17(18,19)20)8-13(12)23(25)26/h2-8,21H,1H3,(H,22,24) |
| InChIKey | BLCRQCSAKVUNOP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|