C18H13F3N2O4 — CID 2947363
3,5-dimethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 2947363) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3,5-dimethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2947363 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 3,5-dimethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2oc(C(=O)Nc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(C)c2c1 |
| InChI | InChI=1S/C18H13F3N2O4/c1-9-3-6-15-12(7-9)10(2)16(27-15)17(24)22-13-5-4-11(18(19,20)21)8-14(13)23(25)26/h3-8H,1-2H3,(H,22,24) |
| InChIKey | GJTMEFQGPHLKKW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|