C16H12F3N5O3 — CID 78869090
5-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indazole-3-carbohydrazide (PubChem CID 78869090) has the molecular formula C16H12F3N5O3 and a molecular weight of 379.30 g/mol. Its IUPAC name is 5-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indazole-3-carbohydrazide.
| Compound Name | 5-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indazole-3-carbohydrazide |
|---|---|
| PubChem CID | 78869090 |
| Molecular Formula | C16H12F3N5O3 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 5-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indazole-3-carbohydrazide |
| SMILES | Cc1ccc2[nH]nc(C(=O)NNc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C16H12F3N5O3/c1-8-2-4-11-10(6-8)14(22-20-11)15(25)23-21-12-5-3-9(16(17,18)19)7-13(12)24(26)27/h2-7,21H,1H3,(H,20,22)(H,23,25) |
| InChIKey | VNCMAXPSAPGNPZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|