C18H15F3N4O3 — CID 29409991
4,6-dimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indole-2-carbohydrazide (PubChem CID 29409991) has the molecular formula C18H15F3N4O3 and a molecular weight of 392.34 g/mol. Its IUPAC name is 4,6-dimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indole-2-carbohydrazide.
| Compound Name | 4,6-dimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 29409991 |
| Molecular Formula | C18H15F3N4O3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4,6-dimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indole-2-carbohydrazide |
| SMILES | Cc1cc(C)c2cc(C(=O)NNc3ccc(C(F)(F)F)cc3[N+](=O)[O-])[nH]c2c1 |
| InChI | InChI=1S/C18H15F3N4O3/c1-9-5-10(2)12-8-15(22-14(12)6-9)17(26)24-23-13-4-3-11(18(19,20)21)7-16(13)25(27)28/h3-8,22-23H,1-2H3,(H,24,26) |
| InChIKey | QPPPXGYUNUQDKI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|