C16H10ClF3N4O3 — CID 55631614
6-chloro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indole-2-carbohydrazide (PubChem CID 55631614) has the molecular formula C16H10ClF3N4O3 and a molecular weight of 398.73 g/mol. Its IUPAC name is 6-chloro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indole-2-carbohydrazide.
| Compound Name | 6-chloro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 55631614 |
| Molecular Formula | C16H10ClF3N4O3 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 6-chloro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indole-2-carbohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1cc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H10ClF3N4O3/c17-10-3-1-8-5-13(21-12(8)7-10)15(25)23-22-11-4-2-9(16(18,19)20)6-14(11)24(26)27/h1-7,21-22H,(H,23,25) |
| InChIKey | YGOKHDGUFPCARH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|