C13H7Cl4N3O4 — CID 31140109
2-(5-nitro-2-oxo-1-pyridinyl)-N-(2,3,5,6-tetrachlorophenyl)acetamide (PubChem CID 31140109) has the molecular formula C13H7Cl4N3O4 and a molecular weight of 411.03 g/mol. Its IUPAC name is 2-(5-nitro-2-oxo-1-pyridinyl)-N-(2,3,5,6-tetrachlorophenyl)acetamide.
| Compound Name | 2-(5-nitro-2-oxo-1-pyridinyl)-N-(2,3,5,6-tetrachlorophenyl)acetamide |
|---|---|
| PubChem CID | 31140109 |
| Molecular Formula | C13H7Cl4N3O4 |
| Molecular Weight | 411.03 g/mol |
| Exact Mass | 408.92 |
| IUPAC Name | 2-(5-nitro-2-oxo-1-pyridinyl)-N-(2,3,5,6-tetrachlorophenyl)acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])ccc1=O)Nc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H7Cl4N3O4/c14-7-3-8(15)12(17)13(11(7)16)18-9(21)5-19-4-6(20(23)24)1-2-10(19)22/h1-4H,5H2,(H,18,21) |
| InChIKey | DSWLDWIXJMKXPN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.03 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|