C18H16Cl4N4O3 — CID 55843110
2-[4-(3-nitrophenyl)piperazin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide (PubChem CID 55843110) has the molecular formula C18H16Cl4N4O3 and a molecular weight of 478.16 g/mol. Its IUPAC name is 2-[4-(3-nitrophenyl)piperazin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide.
| Compound Name | 2-[4-(3-nitrophenyl)piperazin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
|---|---|
| PubChem CID | 55843110 |
| Molecular Formula | C18H16Cl4N4O3 |
| Molecular Weight | 478.16 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | 2-[4-(3-nitrophenyl)piperazin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(c2cccc([N+](=O)[O-])c2)CC1)Nc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C18H16Cl4N4O3/c19-13-9-14(20)17(22)18(16(13)21)23-15(27)10-24-4-6-25(7-5-24)11-2-1-3-12(8-11)26(28)29/h1-3,8-9H,4-7,10H2,(H,23,27) |
| InChIKey | MTCBPCXPRHCTKA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|