C19H20ClN5O4 — CID 55842735
2-chloro-N'-[2-[4-(3-nitrophenyl)piperazin-1-yl]acetyl]benzohydrazide (PubChem CID 55842735) has the molecular formula C19H20ClN5O4 and a molecular weight of 417.85 g/mol. Its IUPAC name is 2-chloro-N'-[2-[4-(3-nitrophenyl)piperazin-1-yl]acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-[4-(3-nitrophenyl)piperazin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 55842735 |
| Molecular Formula | C19H20ClN5O4 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-chloro-N'-[2-[4-(3-nitrophenyl)piperazin-1-yl]acetyl]benzohydrazide |
| SMILES | O=C(CN1CCN(c2cccc([N+](=O)[O-])c2)CC1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H20ClN5O4/c20-17-7-2-1-6-16(17)19(27)22-21-18(26)13-23-8-10-24(11-9-23)14-4-3-5-15(12-14)25(28)29/h1-7,12H,8-11,13H2,(H,21,26)(H,22,27) |
| InChIKey | GKSUVJKWNLSIBG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|