C21H22N6O4 — CID 55849681
N'-[2-[4-(4-cyanophenyl)-1,4-diazepan-1-yl]acetyl]-3-nitrobenzohydrazide (PubChem CID 55849681) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is N'-[2-[4-(4-cyanophenyl)-1,4-diazepan-1-yl]acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[4-(4-cyanophenyl)-1,4-diazepan-1-yl]acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 55849681 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N'-[2-[4-(4-cyanophenyl)-1,4-diazepan-1-yl]acetyl]-3-nitrobenzohydrazide |
| SMILES | N#Cc1ccc(N2CCCN(CC(=O)NNC(=O)c3cccc([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C21H22N6O4/c22-14-16-5-7-18(8-6-16)26-10-2-9-25(11-12-26)15-20(28)23-24-21(29)17-3-1-4-19(13-17)27(30)31/h1,3-8,13H,2,9-12,15H2,(H,23,28)(H,24,29) |
| InChIKey | RECVCANEKQYUDT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|