C20H23ClN4O3 — CID 8590785
N-[(1R)-1-(2-chlorophenyl)ethyl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 8590785) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-[(1R)-1-(2-chlorophenyl)ethyl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8590785 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | C[C@@H](NC(=O)CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1ccccc1Cl |
| InChI | InChI=1S/C20H23ClN4O3/c1-15(18-4-2-3-5-19(18)21)22-20(26)14-23-10-12-24(13-11-23)16-6-8-17(9-7-16)25(27)28/h2-9,15H,10-14H2,1H3,(H,22,26)/t15-/m1/s1 |
| InChIKey | XAPIJZRMZJNBQC-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|