C21H24ClN5O4 — CID 25408858
N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 25408858) has the molecular formula C21H24ClN5O4 and a molecular weight of 445.91 g/mol. Its IUPAC name is N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 25408858 |
| Molecular Formula | C21H24ClN5O4 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H24ClN5O4/c1-24(14-20(28)23-19-5-3-2-4-18(19)22)21(29)15-25-10-12-26(13-11-25)16-6-8-17(9-7-16)27(30)31/h2-9H,10-15H2,1H3,(H,23,28) |
| InChIKey | RFULICQRHGOECN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|