C12H12F3N3O5 — CID 8869434
4-nitro-N'-[(3S)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]benzohydrazide (PubChem CID 8869434) has the molecular formula C12H12F3N3O5 and a molecular weight of 335.24 g/mol. Its IUPAC name is 4-nitro-N'-[(3S)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]benzohydrazide.
| Compound Name | 4-nitro-N'-[(3S)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]benzohydrazide |
|---|---|
| PubChem CID | 8869434 |
| Molecular Formula | C12H12F3N3O5 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 4-nitro-N'-[(3S)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]benzohydrazide |
| SMILES | C[C@](O)(CC(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O5/c1-11(21,12(13,14)15)6-9(19)16-17-10(20)7-2-4-8(5-3-7)18(22)23/h2-5,21H,6H2,1H3,(H,16,19)(H,17,20)/t11-/m0/s1 |
| InChIKey | XIXXVPOJSLTNRQ-NSHDSACASA-N |
| XLogP | 1.06 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|