C16H9F6NO5S — CID 162413850
1-[3,5-bis(trifluoromethyl)phenyl]-2-(4-nitrophenyl)sulfonylethanone (PubChem CID 162413850) has the molecular formula C16H9F6NO5S and a molecular weight of 441.31 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2-(4-nitrophenyl)sulfonylethanone.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-(4-nitrophenyl)sulfonylethanone |
|---|---|
| PubChem CID | 162413850 |
| Molecular Formula | C16H9F6NO5S |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-(4-nitrophenyl)sulfonylethanone |
| SMILES | O=C(CS(=O)(=O)c1ccc([N+](=O)[O-])cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H9F6NO5S/c17-15(18,19)10-5-9(6-11(7-10)16(20,21)22)14(24)8-29(27,28)13-3-1-12(2-4-13)23(25)26/h1-7H,8H2 |
| InChIKey | DXKQIIVYQDZXDC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|