C22H13F6N5O2 — CID 3094160
6-nitro-2-N,3-N-bis[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine (PubChem CID 3094160) has the molecular formula C22H13F6N5O2 and a molecular weight of 493.37 g/mol. Its IUPAC name is 6-nitro-2-N,3-N-bis[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine.
| Compound Name | 6-nitro-2-N,3-N-bis[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 3094160 |
| Molecular Formula | C22H13F6N5O2 |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 6-nitro-2-N,3-N-bis[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine |
| SMILES | O=[N+]([O-])c1ccc2nc(Nc3cccc(C(F)(F)F)c3)c(Nc3cccc(C(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C22H13F6N5O2/c23-21(24,25)12-3-1-5-14(9-12)29-19-20(30-15-6-2-4-13(10-15)22(26,27)28)32-18-11-16(33(34)35)7-8-17(18)31-19/h1-11H,(H,29,31)(H,30,32) |
| InChIKey | CJUJPLWPDCTDEH-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|