C28H14Cl6N8O4 — CID 159675732
2-N,3-N-bis(3,4-dichlorophenyl)-6-nitroquinoxaline-2,3-diamine;2,3-dichloro-6-nitroquinoxaline (PubChem CID 159675732) has the molecular formula C28H14Cl6N8O4 and a molecular weight of 739.19 g/mol. Its IUPAC name is 2-N,3-N-bis(3,4-dichlorophenyl)-6-nitroquinoxaline-2,3-diamine;2,3-dichloro-6-nitroquinoxaline.
| Compound Name | 2-N,3-N-bis(3,4-dichlorophenyl)-6-nitroquinoxaline-2,3-diamine;2,3-dichloro-6-nitroquinoxaline |
|---|---|
| PubChem CID | 159675732 |
| Molecular Formula | C28H14Cl6N8O4 |
| Molecular Weight | 739.19 g/mol |
| Exact Mass | 735.93 |
| IUPAC Name | 2-N,3-N-bis(3,4-dichlorophenyl)-6-nitroquinoxaline-2,3-diamine;2,3-dichloro-6-nitroquinoxaline |
| SMILES | O=[N+]([O-])c1ccc2nc(Cl)c(Cl)nc2c1.O=[N+]([O-])c1ccc2nc(Nc3ccc(Cl)c(Cl)c3)c(Nc3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C20H11Cl4N5O2.C8H3Cl2N3O2/c21-13-4-1-10(7-15(13)23)25-19-20(26-11-2-5-14(22)16(24)8-11)28-18-9-12(29(30)31)3-6-17(18)27-19;9-7-8(10)12-6-3-4(13(14)15)1-2-5(6)11-7/h1-9H,(H,25,27)(H,26,28);1-3H |
| InChIKey | MUOOCCBPINOQIB-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.19 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|