C14H7Cl2N5O4S — CID 59994249
N-(3,4-dichlorophenyl)-5-(3,5-dinitrophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 59994249) has the molecular formula C14H7Cl2N5O4S and a molecular weight of 412.21 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-(3,5-dinitrophenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(3,4-dichlorophenyl)-5-(3,5-dinitrophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 59994249 |
| Molecular Formula | C14H7Cl2N5O4S |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-(3,5-dinitrophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1cc(-c2nnc(Nc3ccc(Cl)c(Cl)c3)s2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H7Cl2N5O4S/c15-11-2-1-8(5-12(11)16)17-14-19-18-13(26-14)7-3-9(20(22)23)6-10(4-7)21(24)25/h1-6H,(H,17,19) |
| InChIKey | WETCRNKMEXOTNS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|