C26H19N5O6 — CID 99886164
(Z)-3-[3-[[3-[3-[(E)-2-carboxyethenyl]anilino]-6-nitroquinoxalin-2-yl]amino]phenyl]prop-2-enoic acid (PubChem CID 99886164) has the molecular formula C26H19N5O6 and a molecular weight of 497.47 g/mol. Its IUPAC name is (Z)-3-[3-[[3-[3-[(E)-2-carboxyethenyl]anilino]-6-nitroquinoxalin-2-yl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[3-[[3-[3-[(E)-2-carboxyethenyl]anilino]-6-nitroquinoxalin-2-yl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 99886164 |
| Molecular Formula | C26H19N5O6 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (Z)-3-[3-[[3-[3-[(E)-2-carboxyethenyl]anilino]-6-nitroquinoxalin-2-yl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C\c1cccc(Nc2nc3ccc([N+](=O)[O-])cc3nc2Nc2cccc(/C=C/C(=O)O)c2)c1 |
| InChI | InChI=1S/C26H19N5O6/c32-23(33)11-7-16-3-1-5-18(13-16)27-25-26(28-19-6-2-4-17(14-19)8-12-24(34)35)30-22-15-20(31(36)37)9-10-21(22)29-25/h1-15H,(H,27,29)(H,28,30)(H,32,33)(H,34,35)/b11-7-,12-8+ |
| InChIKey | AFHNXMQGGNTBDO-NTLHZVPKSA-N |
| XLogP | 5.22 |
| TPSA | 167.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|