C16H10N8O5 — CID 3123790
5-N,6-N-bis(4-nitrophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 3123790) has the molecular formula C16H10N8O5 and a molecular weight of 394.31 g/mol. Its IUPAC name is 5-N,6-N-bis(4-nitrophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N,6-N-bis(4-nitrophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 3123790 |
| Molecular Formula | C16H10N8O5 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 5-N,6-N-bis(4-nitrophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc3nonc3nc2Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H10N8O5/c25-23(26)11-5-1-9(2-6-11)17-13-14(20-16-15(19-13)21-29-22-16)18-10-3-7-12(8-4-10)24(27)28/h1-8H,(H,17,19,21)(H,18,20,22) |
| InChIKey | OJFIVYGJCZXLNE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 175.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|