C28H30N6O6 — CID 157167001
2,4,5-trimethyl-6-(4-nitroanilino)pyridin-3-ol (PubChem CID 157167001) has the molecular formula C28H30N6O6 and a molecular weight of 546.58 g/mol. Its IUPAC name is 2,4,5-trimethyl-6-(4-nitroanilino)pyridin-3-ol.
| Compound Name | 2,4,5-trimethyl-6-(4-nitroanilino)pyridin-3-ol |
|---|---|
| PubChem CID | 157167001 |
| Molecular Formula | C28H30N6O6 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 2,4,5-trimethyl-6-(4-nitroanilino)pyridin-3-ol |
| SMILES | Cc1nc(Nc2ccc([N+](=O)[O-])cc2)c(C)c(C)c1O.Cc1nc(Nc2ccc([N+](=O)[O-])cc2)c(C)c(C)c1O |
| InChI | InChI=1S/2C14H15N3O3/c2*1-8-9(2)14(15-10(3)13(8)18)16-11-4-6-12(7-5-11)17(19)20/h2*4-7,18H,1-3H3,(H,15,16) |
| InChIKey | ANAMRTUBSCTNGF-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|