C11H11N7O4 — CID 4677450
4-N-methyl-5-nitro-2-N-(4-nitrophenyl)pyrimidine-2,4,6-triamine (PubChem CID 4677450) has the molecular formula C11H11N7O4 and a molecular weight of 305.25 g/mol. Its IUPAC name is 4-N-methyl-5-nitro-2-N-(4-nitrophenyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-methyl-5-nitro-2-N-(4-nitrophenyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 4677450 |
| Molecular Formula | C11H11N7O4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-N-methyl-5-nitro-2-N-(4-nitrophenyl)pyrimidine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2ccc([N+](=O)[O-])cc2)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N7O4/c1-13-10-8(18(21)22)9(12)15-11(16-10)14-6-2-4-7(5-3-6)17(19)20/h2-5H,1H3,(H4,12,13,14,15,16) |
| InChIKey | ZTZHKCALNKZRTI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|