C21H30N4O3SSi — CID 151412726
1-[5-[tert-butyl(dimethyl)silyl]oxy-3,4,6-trimethyl-2-pyridinyl]-3-(4-nitrophenyl)thiourea (PubChem CID 151412726) has the molecular formula C21H30N4O3SSi and a molecular weight of 446.65 g/mol. Its IUPAC name is 1-[5-[tert-butyl(dimethyl)silyl]oxy-3,4,6-trimethyl-2-pyridinyl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[5-[tert-butyl(dimethyl)silyl]oxy-3,4,6-trimethyl-2-pyridinyl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 151412726 |
| Molecular Formula | C21H30N4O3SSi |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-[5-[tert-butyl(dimethyl)silyl]oxy-3,4,6-trimethyl-2-pyridinyl]-3-(4-nitrophenyl)thiourea |
| SMILES | Cc1nc(NC(=S)Nc2ccc([N+](=O)[O-])cc2)c(C)c(C)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H30N4O3SSi/c1-13-14(2)19(22-15(3)18(13)28-30(7,8)21(4,5)6)24-20(29)23-16-9-11-17(12-10-16)25(26)27/h9-12H,1-8H3,(H2,22,23,24,29) |
| InChIKey | OYWBGUZPFMLULS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|