C27H21N5O2S — CID 127036022
1-[4-[(2-methylacridin-9-yl)amino]phenyl]-3-(4-nitrophenyl)thiourea (PubChem CID 127036022) has the molecular formula C27H21N5O2S and a molecular weight of 479.57 g/mol. Its IUPAC name is 1-[4-[(2-methylacridin-9-yl)amino]phenyl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[4-[(2-methylacridin-9-yl)amino]phenyl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 127036022 |
| Molecular Formula | C27H21N5O2S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 1-[4-[(2-methylacridin-9-yl)amino]phenyl]-3-(4-nitrophenyl)thiourea |
| SMILES | Cc1ccc2nc3ccccc3c(Nc3ccc(NC(=S)Nc4ccc([N+](=O)[O-])cc4)cc3)c2c1 |
| InChI | InChI=1S/C27H21N5O2S/c1-17-6-15-25-23(16-17)26(22-4-2-3-5-24(22)31-25)28-18-7-9-19(10-8-18)29-27(35)30-20-11-13-21(14-12-20)32(33)34/h2-16H,1H3,(H,28,31)(H2,29,30,35) |
| InChIKey | ZQMJIQWILGLZQC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|