C13H6F4N4O3 — CID 71575556
N-[3-fluoro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 71575556) has the molecular formula C13H6F4N4O3 and a molecular weight of 342.21 g/mol. Its IUPAC name is N-[3-fluoro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | N-[3-fluoro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 71575556 |
| Molecular Formula | C13H6F4N4O3 |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | N-[3-fluoro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cc(F)cc(C(F)(F)F)c2)ccc2nonc12 |
| InChI | InChI=1S/C13H6F4N4O3/c14-7-3-6(13(15,16)17)4-8(5-7)18-10-2-1-9-11(20-24-19-9)12(10)21(22)23/h1-5,18H |
| InChIKey | FBLSAINZUURAAQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|