C14H10N4O5 — CID 2836637
methyl 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzoate (PubChem CID 2836637) has the molecular formula C14H10N4O5 and a molecular weight of 314.26 g/mol. Its IUPAC name is methyl 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzoate.
| Compound Name | methyl 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzoate |
|---|---|
| PubChem CID | 2836637 |
| Molecular Formula | C14H10N4O5 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | methyl 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ccc3nonc3c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10N4O5/c1-22-14(19)8-2-4-9(5-3-8)15-11-7-6-10-12(17-23-16-10)13(11)18(20)21/h2-7,15H,1H3 |
| InChIKey | GRMHFTKMDCTXAY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|