C13H9N5O6 — CID 3280820
N-(4-methoxy-2-nitrophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 3280820) has the molecular formula C13H9N5O6 and a molecular weight of 331.24 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 3280820 |
| Molecular Formula | C13H9N5O6 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | COc1ccc(Nc2ccc3nonc3c2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9N5O6/c1-23-7-2-3-8(11(6-7)17(19)20)14-10-5-4-9-12(16-24-15-9)13(10)18(21)22/h2-6,14H,1H3 |
| InChIKey | BRMGJRYTPPMWKC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|