C11H6ClN5O3 — CID 126478981
N-(2-chloro-3-pyridinyl)-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 126478981) has the molecular formula C11H6ClN5O3 and a molecular weight of 291.65 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | N-(2-chloro-3-pyridinyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 126478981 |
| Molecular Formula | C11H6ClN5O3 |
| Molecular Weight | 291.65 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccnc2Cl)ccc2nonc12 |
| InChI | InChI=1S/C11H6ClN5O3/c12-11-8(2-1-5-13-11)14-7-4-3-6-9(16-20-15-6)10(7)17(18)19/h1-5,14H |
| InChIKey | GMQQHCRHILGFTI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|