C14H11N7O5 — CID 3465839
2-[[7-(2,1,3-benzoxadiazol-4-ylamino)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol (PubChem CID 3465839) has the molecular formula C14H11N7O5 and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-[[7-(2,1,3-benzoxadiazol-4-ylamino)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol.
| Compound Name | 2-[[7-(2,1,3-benzoxadiazol-4-ylamino)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol |
|---|---|
| PubChem CID | 3465839 |
| Molecular Formula | C14H11N7O5 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[[7-(2,1,3-benzoxadiazol-4-ylamino)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol |
| SMILES | O=[N+]([O-])c1c(NCCO)cc(Nc2cccc3nonc23)c2nonc12 |
| InChI | InChI=1S/C14H11N7O5/c22-5-4-15-10-6-9(12-13(20-26-19-12)14(10)21(23)24)16-7-2-1-3-8-11(7)18-25-17-8/h1-3,6,15-16,22H,4-5H2 |
| InChIKey | GPOFIWJPVBLQSG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 165.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|