C13H11BrN6O4 — CID 3517782
2-[[7-[(5-bromo-2-pyridinyl)amino]-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol (PubChem CID 3517782) has the molecular formula C13H11BrN6O4 and a molecular weight of 395.17 g/mol. Its IUPAC name is 2-[[7-[(5-bromo-2-pyridinyl)amino]-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol.
| Compound Name | 2-[[7-[(5-bromo-2-pyridinyl)amino]-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol |
|---|---|
| PubChem CID | 3517782 |
| Molecular Formula | C13H11BrN6O4 |
| Molecular Weight | 395.17 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 2-[[7-[(5-bromo-2-pyridinyl)amino]-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol |
| SMILES | O=[N+]([O-])c1c(NCCO)cc(Nc2ccc(Br)cn2)c2nonc12 |
| InChI | InChI=1S/C13H11BrN6O4/c14-7-1-2-10(16-6-7)17-8-5-9(15-3-4-21)13(20(22)23)12-11(8)18-24-19-12/h1-2,5-6,15,21H,3-4H2,(H,16,17) |
| InChIKey | UDESCSWQFCKZPQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 139.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|