C15H12N6O4 — CID 3829219
2-[[5-(2-hydroxyethylamino)-4-nitro-2,1,3-benzoxadiazol-7-yl]amino]benzonitrile (PubChem CID 3829219) has the molecular formula C15H12N6O4 and a molecular weight of 340.30 g/mol. Its IUPAC name is 2-[[5-(2-hydroxyethylamino)-4-nitro-2,1,3-benzoxadiazol-7-yl]amino]benzonitrile.
| Compound Name | 2-[[5-(2-hydroxyethylamino)-4-nitro-2,1,3-benzoxadiazol-7-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 3829219 |
| Molecular Formula | C15H12N6O4 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-[[5-(2-hydroxyethylamino)-4-nitro-2,1,3-benzoxadiazol-7-yl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1Nc1cc(NCCO)c([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C15H12N6O4/c16-8-9-3-1-2-4-10(9)18-11-7-12(17-5-6-22)15(21(23)24)14-13(11)19-25-20-14/h1-4,7,17-18,22H,5-6H2 |
| InChIKey | UOQOHVATWBSRBM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 150.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|