C15H15N5O4 — CID 3555705
2-[[7-(benzylamino)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol (PubChem CID 3555705) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-[[7-(benzylamino)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol.
| Compound Name | 2-[[7-(benzylamino)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol |
|---|---|
| PubChem CID | 3555705 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[[7-(benzylamino)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]ethanol |
| SMILES | O=[N+]([O-])c1c(NCCO)cc(NCc2ccccc2)c2nonc12 |
| InChI | InChI=1S/C15H15N5O4/c21-7-6-16-12-8-11(17-9-10-4-2-1-3-5-10)13-14(19-24-18-13)15(12)20(22)23/h1-5,8,16-17,21H,6-7,9H2 |
| InChIKey | NIRVWQZRPKIHGZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|