C25H24N6O5 — CID 3612883
7-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-benzyl-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 3612883) has the molecular formula C25H24N6O5 and a molecular weight of 488.50 g/mol. Its IUPAC name is 7-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-benzyl-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | 7-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-benzyl-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 3612883 |
| Molecular Formula | C25H24N6O5 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 7-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-benzyl-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccccc2)cc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c2nonc12 |
| InChI | InChI=1S/C25H24N6O5/c32-31(33)25-19(26-14-17-4-2-1-3-5-17)13-20(23-24(25)28-36-27-23)30-10-8-29(9-11-30)15-18-6-7-21-22(12-18)35-16-34-21/h1-7,12-13,26H,8-11,14-16H2 |
| InChIKey | OQMCEPQNBOGDTC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|