C25H27N3O2 — CID 19644583
N-(1,3-benzodioxol-5-ylmethyl)-4-(4-benzylpiperazin-1-yl)aniline (PubChem CID 19644583) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-(4-benzylpiperazin-1-yl)aniline.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(4-benzylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 19644583 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(4-benzylpiperazin-1-yl)aniline |
| SMILES | c1ccc(CN2CCN(c3ccc(NCc4ccc5c(c4)OCO5)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H27N3O2/c1-2-4-20(5-3-1)18-27-12-14-28(15-13-27)23-9-7-22(8-10-23)26-17-21-6-11-24-25(16-21)30-19-29-24/h1-11,16,26H,12-15,17-19H2 |
| InChIKey | SOBJDTSFLNMKFO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|