C23H31N5O2 — CID 111845557
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(4-benzylpiperazin-1-yl)ethyl]-2-methylguanidine (PubChem CID 111845557) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(4-benzylpiperazin-1-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(4-benzylpiperazin-1-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111845557 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(4-benzylpiperazin-1-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN1CCN(Cc2ccccc2)CC1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H31N5O2/c1-24-23(26-16-20-7-8-21-22(15-20)30-18-29-21)25-9-10-27-11-13-28(14-12-27)17-19-5-3-2-4-6-19/h2-8,15H,9-14,16-18H2,1H3,(H2,24,25,26) |
| InChIKey | CPTDMIGQPTXTPI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|