C21H20N6O4 — CID 3764818
2-[[4-nitro-7-[N-(1-pyridin-3-ylethyl)anilino]-2,1,3-benzoxadiazol-5-yl]amino]ethanol (PubChem CID 3764818) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is 2-[[4-nitro-7-[N-(1-pyridin-3-ylethyl)anilino]-2,1,3-benzoxadiazol-5-yl]amino]ethanol.
| Compound Name | 2-[[4-nitro-7-[N-(1-pyridin-3-ylethyl)anilino]-2,1,3-benzoxadiazol-5-yl]amino]ethanol |
|---|---|
| PubChem CID | 3764818 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-[[4-nitro-7-[N-(1-pyridin-3-ylethyl)anilino]-2,1,3-benzoxadiazol-5-yl]amino]ethanol |
| SMILES | CC(c1cccnc1)N(c1ccccc1)c1cc(NCCO)c([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C21H20N6O4/c1-14(15-6-5-9-22-13-15)26(16-7-3-2-4-8-16)18-12-17(23-10-11-28)21(27(29)30)20-19(18)24-31-25-20/h2-9,12-14,23,28H,10-11H2,1H3 |
| InChIKey | KNEZTHBYYGHHND-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 130.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|