C14H12IN5O3 — CID 3750592
7-N-ethyl-5-N-(2-iodophenyl)-4-nitro-2,1,3-benzoxadiazole-5,7-diamine (PubChem CID 3750592) has the molecular formula C14H12IN5O3 and a molecular weight of 425.19 g/mol. Its IUPAC name is 7-N-ethyl-5-N-(2-iodophenyl)-4-nitro-2,1,3-benzoxadiazole-5,7-diamine.
| Compound Name | 7-N-ethyl-5-N-(2-iodophenyl)-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
|---|---|
| PubChem CID | 3750592 |
| Molecular Formula | C14H12IN5O3 |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 7-N-ethyl-5-N-(2-iodophenyl)-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
| SMILES | CCNc1cc(Nc2ccccc2I)c([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C14H12IN5O3/c1-2-16-10-7-11(17-9-6-4-3-5-8(9)15)14(20(21)22)13-12(10)18-23-19-13/h3-7,16-17H,2H2,1H3 |
| InChIKey | KUYQKTQLJDBKII-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|