C13H9ClN4O4 — CID 2836597
7-chloro-N-(4-methoxyphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 2836597) has the molecular formula C13H9ClN4O4 and a molecular weight of 320.69 g/mol. Its IUPAC name is 7-chloro-N-(4-methoxyphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | 7-chloro-N-(4-methoxyphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 2836597 |
| Molecular Formula | C13H9ClN4O4 |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 7-chloro-N-(4-methoxyphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | COc1ccc(Nc2cc(Cl)c3nonc3c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9ClN4O4/c1-21-8-4-2-7(3-5-8)15-10-6-9(14)11-12(17-22-16-11)13(10)18(19)20/h2-6,15H,1H3 |
| InChIKey | CLUXLTSHVTWONO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|