C17H16N6O6 — CID 3782877
N-(4-methoxy-2-nitrophenyl)-4-nitro-5-pyrrolidin-1-yl-2,1,3-benzoxadiazol-7-amine (PubChem CID 3782877) has the molecular formula C17H16N6O6 and a molecular weight of 400.35 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-4-nitro-5-pyrrolidin-1-yl-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-4-nitro-5-pyrrolidin-1-yl-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 3782877 |
| Molecular Formula | C17H16N6O6 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-4-nitro-5-pyrrolidin-1-yl-2,1,3-benzoxadiazol-7-amine |
| SMILES | COc1ccc(Nc2cc(N3CCCC3)c([N+](=O)[O-])c3nonc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N6O6/c1-28-10-4-5-11(13(8-10)22(24)25)18-12-9-14(21-6-2-3-7-21)17(23(26)27)16-15(12)19-29-20-16/h4-5,8-9,18H,2-3,6-7H2,1H3 |
| InChIKey | OMKDEXSFVLOZAK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|