C18H19N5O5 — CID 2937325
N-(4-ethoxyphenyl)-7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 2937325) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | N-(4-ethoxyphenyl)-7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 2937325 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-(4-ethoxyphenyl)-7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | CCOc1ccc(Nc2cc(N3CCOCC3)c3nonc3c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N5O5/c1-2-27-13-5-3-12(4-6-13)19-14-11-15(22-7-9-26-10-8-22)16-17(21-28-20-16)18(14)23(24)25/h3-6,11,19H,2,7-10H2,1H3 |
| InChIKey | CAGSFIIDGXOFTO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|