C18H17Cl2N5O3 — CID 4265216
7-(azepan-1-yl)-N-(2,5-dichlorophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 4265216) has the molecular formula C18H17Cl2N5O3 and a molecular weight of 422.27 g/mol. Its IUPAC name is 7-(azepan-1-yl)-N-(2,5-dichlorophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | 7-(azepan-1-yl)-N-(2,5-dichlorophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 4265216 |
| Molecular Formula | C18H17Cl2N5O3 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 7-(azepan-1-yl)-N-(2,5-dichlorophenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cc(Cl)ccc2Cl)cc(N2CCCCCC2)c2nonc12 |
| InChI | InChI=1S/C18H17Cl2N5O3/c19-11-5-6-12(20)13(9-11)21-14-10-15(24-7-3-1-2-4-8-24)16-17(23-28-22-16)18(14)25(26)27/h5-6,9-10,21H,1-4,7-8H2 |
| InChIKey | QDOPHCITCGVDRM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|