C18H19N5O4 — CID 3720812
3-[[7-(4-methylpiperidin-1-yl)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]phenol (PubChem CID 3720812) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is 3-[[7-(4-methylpiperidin-1-yl)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]phenol.
| Compound Name | 3-[[7-(4-methylpiperidin-1-yl)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]phenol |
|---|---|
| PubChem CID | 3720812 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 3-[[7-(4-methylpiperidin-1-yl)-4-nitro-2,1,3-benzoxadiazol-5-yl]amino]phenol |
| SMILES | CC1CCN(c2cc(Nc3cccc(O)c3)c([N+](=O)[O-])c3nonc23)CC1 |
| InChI | InChI=1S/C18H19N5O4/c1-11-5-7-22(8-6-11)15-10-14(19-12-3-2-4-13(24)9-12)18(23(25)26)17-16(15)20-27-21-17/h2-4,9-11,19,24H,5-8H2,1H3 |
| InChIKey | LJCVXLLGDBSMKL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|