C17H19N5O6 — CID 3716085
2-[[7-(2,5-dimethoxyanilino)-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol (PubChem CID 3716085) has the molecular formula C17H19N5O6 and a molecular weight of 389.37 g/mol. Its IUPAC name is 2-[[7-(2,5-dimethoxyanilino)-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol.
| Compound Name | 2-[[7-(2,5-dimethoxyanilino)-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 3716085 |
| Molecular Formula | C17H19N5O6 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[[7-(2,5-dimethoxyanilino)-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol |
| SMILES | COc1ccc(OC)c(Nc2cc(N(C)CCO)c([N+](=O)[O-])c3nonc23)c1 |
| InChI | InChI=1S/C17H19N5O6/c1-21(6-7-23)13-9-12(15-16(20-28-19-15)17(13)22(24)25)18-11-8-10(26-2)4-5-14(11)27-3/h4-5,8-9,18,23H,6-7H2,1-3H3 |
| InChIKey | IQSRIKQDGSKKAB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|