C13H11BrN6O3 — CID 3334979
7-N-(5-bromo-2-pyridinyl)-5-N,5-N-dimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine (PubChem CID 3334979) has the molecular formula C13H11BrN6O3 and a molecular weight of 379.17 g/mol. Its IUPAC name is 7-N-(5-bromo-2-pyridinyl)-5-N,5-N-dimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine.
| Compound Name | 7-N-(5-bromo-2-pyridinyl)-5-N,5-N-dimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
|---|---|
| PubChem CID | 3334979 |
| Molecular Formula | C13H11BrN6O3 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 7-N-(5-bromo-2-pyridinyl)-5-N,5-N-dimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
| SMILES | CN(C)c1cc(Nc2ccc(Br)cn2)c2nonc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11BrN6O3/c1-19(2)9-5-8(16-10-4-3-7(14)6-15-10)11-12(18-23-17-11)13(9)20(21)22/h3-6H,1-2H3,(H,15,16) |
| InChIKey | JSSOXWAFERMUEL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|