C17H21N5O4 — CID 3758031
7-N-[4-(furan-2-yl)butan-2-yl]-5-N,5-N,7-N-trimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine (PubChem CID 3758031) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 7-N-[4-(furan-2-yl)butan-2-yl]-5-N,5-N,7-N-trimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine.
| Compound Name | 7-N-[4-(furan-2-yl)butan-2-yl]-5-N,5-N,7-N-trimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
|---|---|
| PubChem CID | 3758031 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 7-N-[4-(furan-2-yl)butan-2-yl]-5-N,5-N,7-N-trimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
| SMILES | CC(CCc1ccco1)N(C)c1cc(N(C)C)c([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C17H21N5O4/c1-11(7-8-12-6-5-9-25-12)21(4)13-10-14(20(2)3)17(22(23)24)16-15(13)18-26-19-16/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | SVYXFFIYRKHKKH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|