C10H13N5O3 — CID 6617215
7-N,7-N-diethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine (PubChem CID 6617215) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 7-N,7-N-diethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine.
| Compound Name | 7-N,7-N-diethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
|---|---|
| PubChem CID | 6617215 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 7-N,7-N-diethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
| SMILES | CCN(CC)c1cc(N)c([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C10H13N5O3/c1-3-14(4-2)7-5-6(11)10(15(16)17)9-8(7)12-18-13-9/h5H,3-4,11H2,1-2H3 |
| InChIKey | SRQQFLGQTVNYFB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|