C25H26N6O3 — CID 3696532
N,N-dibenzyl-5-(4-methylpiperazin-1-yl)-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 3696532) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is N,N-dibenzyl-5-(4-methylpiperazin-1-yl)-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N,N-dibenzyl-5-(4-methylpiperazin-1-yl)-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 3696532 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | N,N-dibenzyl-5-(4-methylpiperazin-1-yl)-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CN1CCN(c2cc(N(Cc3ccccc3)Cc3ccccc3)c3nonc3c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C25H26N6O3/c1-28-12-14-29(15-13-28)22-16-21(23-24(27-34-26-23)25(22)31(32)33)30(17-19-8-4-2-5-9-19)18-20-10-6-3-7-11-20/h2-11,16H,12-15,17-18H2,1H3 |
| InChIKey | WZHPIQXTPKUDDH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 91.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|