C26H34N6O4 — CID 3562734
N-(2,2-dimethyloxan-4-yl)-5-(4-methylpiperazin-1-yl)-4-nitro-N-(1-phenylethyl)-2,1,3-benzoxadiazol-7-amine (PubChem CID 3562734) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-5-(4-methylpiperazin-1-yl)-4-nitro-N-(1-phenylethyl)-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-5-(4-methylpiperazin-1-yl)-4-nitro-N-(1-phenylethyl)-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 3562734 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-5-(4-methylpiperazin-1-yl)-4-nitro-N-(1-phenylethyl)-2,1,3-benzoxadiazol-7-amine |
| SMILES | CC(c1ccccc1)N(c1cc(N2CCN(C)CC2)c([N+](=O)[O-])c2nonc12)C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C26H34N6O4/c1-18(19-8-6-5-7-9-19)31(20-10-15-35-26(2,3)17-20)21-16-22(30-13-11-29(4)12-14-30)25(32(33)34)24-23(21)27-36-28-24/h5-9,16,18,20H,10-15,17H2,1-4H3 |
| InChIKey | YJXLZVCVPWQASR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 101.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|