C25H25N5O4 — CID 3348443
N-benzyl-5-morpholin-4-yl-4-nitro-N-(2-phenylethyl)-2,1,3-benzoxadiazol-7-amine (PubChem CID 3348443) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is N-benzyl-5-morpholin-4-yl-4-nitro-N-(2-phenylethyl)-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-benzyl-5-morpholin-4-yl-4-nitro-N-(2-phenylethyl)-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 3348443 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-benzyl-5-morpholin-4-yl-4-nitro-N-(2-phenylethyl)-2,1,3-benzoxadiazol-7-amine |
| SMILES | O=[N+]([O-])c1c(N2CCOCC2)cc(N(CCc2ccccc2)Cc2ccccc2)c2nonc12 |
| InChI | InChI=1S/C25H25N5O4/c31-30(32)25-22(28-13-15-33-16-14-28)17-21(23-24(25)27-34-26-23)29(18-20-9-5-2-6-10-20)12-11-19-7-3-1-4-8-19/h1-10,17H,11-16,18H2 |
| InChIKey | JYOMIJMPTWZSRC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|