C22H25N5O6 — CID 3379324
N-[(2,5-dimethoxyphenyl)methyl]-5-morpholin-4-yl-4-nitro-N-prop-2-enyl-2,1,3-benzoxadiazol-7-amine (PubChem CID 3379324) has the molecular formula C22H25N5O6 and a molecular weight of 455.47 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-5-morpholin-4-yl-4-nitro-N-prop-2-enyl-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-5-morpholin-4-yl-4-nitro-N-prop-2-enyl-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 3379324 |
| Molecular Formula | C22H25N5O6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-5-morpholin-4-yl-4-nitro-N-prop-2-enyl-2,1,3-benzoxadiazol-7-amine |
| SMILES | C=CCN(Cc1cc(OC)ccc1OC)c1cc(N2CCOCC2)c([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C22H25N5O6/c1-4-7-26(14-15-12-16(30-2)5-6-19(15)31-3)17-13-18(25-8-10-32-11-9-25)22(27(28)29)21-20(17)23-33-24-21/h4-6,12-13H,1,7-11,14H2,2-3H3 |
| InChIKey | IGQOVYPAJVMSFV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 116.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|