C16H20N4O4 — CID 3827133
N-[(2,5-dimethoxyphenyl)methyl]-2-methyl-5-nitro-N-prop-2-enyl-1H-imidazol-4-amine (PubChem CID 3827133) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-2-methyl-5-nitro-N-prop-2-enyl-1H-imidazol-4-amine.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-2-methyl-5-nitro-N-prop-2-enyl-1H-imidazol-4-amine |
|---|---|
| PubChem CID | 3827133 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-2-methyl-5-nitro-N-prop-2-enyl-1H-imidazol-4-amine |
| SMILES | C=CCN(Cc1cc(OC)ccc1OC)c1nc(C)[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N4O4/c1-5-8-19(15-16(20(21)22)18-11(2)17-15)10-12-9-13(23-3)6-7-14(12)24-4/h5-7,9H,1,8,10H2,2-4H3,(H,17,18) |
| InChIKey | NSYWAQDGJRDSHI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|