C14H19NO5 — CID 150562472
(2,5-dimethoxyphenyl)methyl morpholine-4-carboxylate (PubChem CID 150562472) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl morpholine-4-carboxylate.
| Compound Name | (2,5-dimethoxyphenyl)methyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 150562472 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl morpholine-4-carboxylate |
| SMILES | COc1ccc(OC)c(COC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C14H19NO5/c1-17-12-3-4-13(18-2)11(9-12)10-20-14(16)15-5-7-19-8-6-15/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | IKDATMBJIMOLOL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |